EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 455.551 |
| Monoisotopic Mass | 455.23079 |
| SMILES | C[C@@H](CN1CCC(Cc2ccccc2)CC1)[C@@H](O)c1ccc(O)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C22H29NO2.C4H4O4/c1-17(22(25)20-7-9-21(24)10-8-20)16-23-13-11-19(12-14-23)15-18-5-3-2-4-6-18;5-3(6)1-2-4(7)8/h2-10,17,19,22,24-25H,11-16H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t17-,22+;/m0./s1 |
| InChIKey | FYJZEHCQSUBZDY-SEELMCCHSA-N |
| Roles Classification |
|---|
| Biological Role: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ro 25-6981 maleate (CHEBI:180901) has part Ro 25-6981(1+) (CHEBI:183314) |
| Ro 25-6981 maleate (CHEBI:180901) has role anticonvulsant (CHEBI:35623) |
| Ro 25-6981 maleate (CHEBI:180901) has role antidepressant (CHEBI:35469) |
| Ro 25-6981 maleate (CHEBI:180901) has role neuroprotective agent (CHEBI:63726) |
| Ro 25-6981 maleate (CHEBI:180901) has role NMDA receptor antagonist (CHEBI:60643) |
| Ro 25-6981 maleate (CHEBI:180901) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 4-[(1R,2S)-3-(4-benzylpiperidin-1-yl)-1-hydroxy-2-methylpropyl]phenol (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| Ro 25-6981 (maleate) | ChEBI |
| αR-(4-hydroxyphenyl)-βS-methyl-4-(phenylmethyl)-1-piperidinepropanol, 2Z-butenedioate | ChEBI |
| (αR,βS)-α-(4-hydroxyphenyl)-β-methyl-4-(phenylmethyl)-1-piperidinepropanol maleate | ChEBI |
| 4-((1R,2S)-3-(4-benzylpiperidin-1-yl)-1-hydroxy-2-methylpropyl)phenol maleate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 21475062 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1312991-76-6 | ChEBI |
| Citations |
|---|