EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O2 |
| Net Charge | 0 |
| Average Mass | 292.463 |
| Monoisotopic Mass | 292.24023 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](O)CC[C@@]34[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C19H32O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-17,20-21H,3-11H2,1-2H3/t12-,13-,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | CBMYJHIOYJEBSB-YSZCXEEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Changes in the Metabolic Elimination Profile of Testosterone Following Exposure of the Crustacean Daphnia magna to TributyltinGerald A. LeBlanc and James B. McLachlanEcotoxicology and Environmental Safety 45, 296-303 (2000)) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15958594) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-androstane-3β,17β-diol (CHEBI:18329) has role Daphnia magna metabolite (CHEBI:83056) |
| 5α-androstane-3β,17β-diol (CHEBI:18329) has role human metabolite (CHEBI:77746) |
| 5α-androstane-3β,17β-diol (CHEBI:18329) is a 17β-hydroxy steroid (CHEBI:35343) |
| 5α-androstane-3β,17β-diol (CHEBI:18329) is a 3β-hydroxy steroid (CHEBI:36836) |
| 5α-androstane-3β,17β-diol (CHEBI:18329) is a androstane-3,17-diol (CHEBI:27727) |
| Incoming Relation(s) |
| (3β,5α,17β)-3-hydroxyandrostan-17-yl sulfate (CHEBI:138032) has functional parent 5α-androstane-3β,17β-diol (CHEBI:18329) |
| 5α-androstane-3α,17β-diol disulfate (CHEBI:133101) has functional parent 5α-androstane-3β,17β-diol (CHEBI:18329) |
| 5α-androstane-3β,17β-diol 17-O-(β-D-glucuronide) (CHEBI:138022) has functional parent 5α-androstane-3β,17β-diol (CHEBI:18329) |
| 5α-androstane-3β,17β-diol disulfate (CHEBI:133115) has functional parent 5α-androstane-3β,17β-diol (CHEBI:18329) |
| IUPAC Name |
|---|
| 5α-androstane-3β,17β-diol |
| Synonyms | Source |
|---|---|
| 3β,17β-dihydroxy-5α-androstane | NIST Chemistry WebBook |
| (3β,5α,17β)-androstane-3,17-diol | NIST Chemistry WebBook |
| 5alpha-Androstan-3beta,17beta-diol | KEGG COMPOUND |
| 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | PDBeChem |
| UniProt Name | Source |
|---|---|
| 5α-androstane-3β,17β-diol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| AOM | PDBeChem |
| C12525 | KEGG COMPOUND |
| DB03882 | DrugBank |
| HMDB0000493 | HMDB |
| LMST02020053 | LIPID MAPS |
| Citations |
|---|