EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O5S |
| Net Charge | 0 |
| Average Mass | 372.527 |
| Monoisotopic Mass | 372.19705 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](OS(=O)(=O)O)CC[C@@]34[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C19H32O5S/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(24-25(21,22)23)19(15,2)10-8-16(14)18/h12-17,20H,3-11H2,1-2H3,(H,21,22,23)/t12-,13-,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | KWYNDVHEQWYGIL-YSZCXEEOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3β,5α,17β)-3-hydroxyandrostan-17-yl sulfate (CHEBI:138032) has functional parent 5α-androstane-3β,17β-diol (CHEBI:18329) |
| (3β,5α,17β)-3-hydroxyandrostan-17-yl sulfate (CHEBI:138032) is a 3β-hydroxy steroid (CHEBI:36836) |
| (3β,5α,17β)-3-hydroxyandrostan-17-yl sulfate (CHEBI:138032) is a androstane sulfate (CHEBI:131647) |
| (3β,5α,17β)-3-hydroxyandrostan-17-yl sulfate (CHEBI:138032) is conjugate acid of (3β,5α,17β)-3-hydroxyandrostan-17-yl sulfate(1−) (CHEBI:136983) |
| Incoming Relation(s) |
| (3β,5α,17β)-3-hydroxyandrostan-17-yl sulfate(1−) (CHEBI:136983) is conjugate base of (3β,5α,17β)-3-hydroxyandrostan-17-yl sulfate (CHEBI:138032) |
| Synonyms | Source |
|---|---|
| (3β,5α,17β)-3-hydroxyandrostan-17-yl hydrogen sulfate | IUPAC |
| 3β-hydroxy-5α-androstan-17β-yl hydrogen sulfate | ChEBI |
| 5α-androstane-3β,17β diol 17-sulfate | ChEBI |
| Citations |
|---|