EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14NO6P |
| Net Charge | 0 |
| Average Mass | 287.208 |
| Monoisotopic Mass | 287.05587 |
| SMILES | O=P(O)(O)OCC(O)C(O)c1cnc2ccccc12 |
| InChI | InChI=1S/C11H14NO6P/c13-10(6-18-19(15,16)17)11(14)8-5-12-9-4-2-1-3-7(8)9/h1-5,10-14H,6H2,(H2,15,16,17) |
| InChIKey | NQEQTYPJSIEPHW-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-C-(indol-3-yl)glycerol 3-phosphate (CHEBI:18299) has functional parent glycerol (CHEBI:17754) |
| 1-C-(indol-3-yl)glycerol 3-phosphate (CHEBI:18299) is a sn-glycerol 3-phosphates (CHEBI:26706) |
| 1-C-(indol-3-yl)glycerol 3-phosphate (CHEBI:18299) is conjugate acid of 1-C-(indol-3-yl)glycerol 3-phosphate(2−) (CHEBI:60820) |
| Incoming Relation(s) |
| (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate (CHEBI:51793) is a 1-C-(indol-3-yl)glycerol 3-phosphate (CHEBI:18299) |
| 1-C-(indol-3-yl)glycerol 3-phosphate(2−) (CHEBI:60820) is conjugate base of 1-C-(indol-3-yl)glycerol 3-phosphate (CHEBI:18299) |
| IUPAC Name |
|---|
| 2,3-dihydroxy-3-(1H-indol-3-yl)propyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| 1-(Indol-3-yl)glycerol 3-phosphate | KEGG COMPOUND |
| (3-Indolyl)-glycerol phosphate | KEGG COMPOUND |
| C1-(3-Indolyl)-glycerol 3-phosphate | KEGG COMPOUND |
| IGPS | ChemIDplus |
| Indole-3-glycerophosphate | ChemIDplus |
| Indoleglycerol phosphate | KEGG COMPOUND |