EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O6 |
| Net Charge | 0 |
| Average Mass | 352.427 |
| Monoisotopic Mass | 352.18859 |
| SMILES | CCC(C)C(O)C(C)(O)C=CC1=CC2=CC(=O)C(C)(O)C(O)C2CO1 |
| InChI | InChI=1S/C19H28O6/c1-5-11(2)16(21)18(3,23)7-6-13-8-12-9-15(20)19(4,24)17(22)14(12)10-25-13/h6-9,11,14,16-17,21-24H,5,10H2,1-4H3 |
| InChIKey | ZMOXNUGOJSHBRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3,4-Dihydroxy-3,5-dimethylhept-1-enyl)-7,8-dihydroxy-7-methyl-8,8a-dihydro-1H-isochromen-6-one (CHEBI:182297) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxy-3,5-dimethylhept-1-enyl)-7,8-dihydroxy-7-methyl-8,8a-dihydro-1H-isochromen-6-one |