EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18217 - α-D-Gal-(1→3)-β-D-Gal-(1→4)-D-GlcNAc
| Formula | C20H35NO16 |
| Net Charge | 0 |
| Average Mass | 545.491 |
| Monoisotopic Mass | 545.19558 |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@H]2O)[C@@H]1O |
| InChI | InChI=1S/C20H35NO16/c1-5(25)21-9-12(28)16(8(4-24)33-18(9)32)36-20-15(31)17(11(27)7(3-23)35-20)37-19-14(30)13(29)10(26)6(2-22)34-19/h6-20,22-24,26-32H,2-4H2,1H3,(H,21,25)/t6-,7-,8-,9-,10+,11+,12-,13+,14-,15-,16-,17+,18?,19-,20+/m1/s1 |
| InChIKey | NNISLDGFPWIBDF-MPRBLYSKSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-Gal-(1→3)-β-D-Gal-(1→4)-D-GlcNAc (CHEBI:18217) has role allergen (CHEBI:50904) |
| α-D-Gal-(1→3)-β-D-Gal-(1→4)-D-GlcNAc (CHEBI:18217) is a amino trisaccharide (CHEBI:59266) |
| α-D-Gal-(1→3)-β-D-Gal-(1→4)-D-GlcNAc (CHEBI:18217) is a glucosamine oligosaccharide (CHEBI:22485) |
| Incoming Relation(s) |
| α-D-Galp-(1→3)-β-D-Galp-(1→4)-β-D-GlcpNAc (CHEBI:62327) is a α-D-Gal-(1→3)-β-D-Gal-(1→4)-D-GlcNAc (CHEBI:18217) |
| α-D-Galp-(1→3)-β-D-Galp-(1→4)-D-GlcpNAc-yl group (CHEBI:17785) is substituent group from α-D-Gal-(1→3)-β-D-Gal-(1→4)-D-GlcNAc (CHEBI:18217) |
| IUPAC Name |
|---|
| α-D-galactopyranosyl-(1→3)-β-D-galactopyranosyl-(1→4)-2-acetamido-2-deoxy-D-glucopyranose |
| Synonyms | Source |
|---|---|
| alpha-D-Galactosyl-1,3-beta-D-galactosyl-1,4-N-acetyl-D-glucosamine | KEGG COMPOUND |
| α-D-Galp-(1→3)-β-D-Galp-(1→4)-D-GlcNAc | JCBN |
| α-D-Galp-(1→3)-β-D-Galp-(1→4)-D-GlcpNAc | ChEBI |
| (Gal)2 (GlcNAc)1 | KEGG GLYCAN |
| αGal1-3βGal1-4GlcNAc | ChEBI |
| Galα1-3Galβ1-4GlcNAc | ChEBI |
| UniProt Name | Source |
|---|---|
| α-D-galactosyl-1,3-β-D-galactosyl-1,4-N-acetyl-D-glucosamine | UniProt |
| Citations |
|---|