EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O7 |
| Net Charge | 0 |
| Average Mass | 400.427 |
| Monoisotopic Mass | 400.15220 |
| SMILES | C/C=C/C1=CC2=C(CO1)C(=O)C(C)(O)C(OC(=O)c1c(C)cc(OC)cc1O)C2 |
| InChI | InChI=1S/C22H24O7/c1-5-6-14-8-13-9-18(22(3,26)20(24)16(13)11-28-14)29-21(25)19-12(2)7-15(27-4)10-17(19)23/h5-8,10,18,23,26H,9,11H2,1-4H3/b6-5+ |
| InChIKey | VNQRSFQBEKLVHZ-AATRIKPKSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [7-hydroxy-7-methyl-8-oxo-3-[(E)-prop-1-enyl]-5,6-dihydro-1H-isochromen-6-yl] 2-hydroxy-4-methoxy-6-methylbenzoate (CHEBI:181064) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [7-hydroxy-7-methyl-8-oxo-3-[(E)-prop-1-enyl]-5,6-dihydro-1H-isochromen-6-yl] 2-hydroxy-4-methoxy-6-methylbenzoate |
| Manual Xrefs | Databases |
|---|---|
| 22943192 | ChemSpider |