EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | C/C=C\CCC1CCCC(=O)O1 |
| InChI | InChI=1S/C10H16O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h2-3,9H,4-8H2,1H3/b3-2- |
| InChIKey | NBCMACYORPIYNY-IHWYPQMZSA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-jasmolactone (CHEBI:180938) is a jasmolactone (CHEBI:167499) |
| IUPAC Name |
|---|
| 6-[(3Z)-pent-3-en-1-yl]tetrahydro-2H-pyran-2-one |
| Synonyms | Source |
|---|---|
| 6-[(3Z)-pent-3-en-1-yl]oxan-2-one | IUPAC |
| (Z)-8-decen-5-olide | ChemIDplus |
| tetrahydro-6-(3Z)-3-penten-1-yl-2H-pyran-2-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 32697701 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1062323-04-9 | ChemIDplus |