EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | [H]C(C)=C([H])CCC1CCCC(=O)O1 |
| InChI | InChI=1S/C10H16O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h2-3,9H,4-8H2,1H3 |
| InChIKey | NBCMACYORPIYNY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jasminum multiflorum (ncbitaxon:310423) | - | DOI (10.1016/j.indcrop.2015.05.053) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jasmolactone (CHEBI:167499) has role flavouring agent (CHEBI:35617) |
| jasmolactone (CHEBI:167499) has role fragrance (CHEBI:48318) |
| jasmolactone (CHEBI:167499) has role plant metabolite (CHEBI:76924) |
| jasmolactone (CHEBI:167499) is a 2-pyranones (CHEBI:75885) |
| jasmolactone (CHEBI:167499) is a olefinic compound (CHEBI:78840) |
| Incoming Relation(s) |
| (E)-jasmolactone (CHEBI:180937) is a jasmolactone (CHEBI:167499) |
| (Z)-jasmolactone (CHEBI:180938) is a jasmolactone (CHEBI:167499) |
| IUPAC Name |
|---|
| 6-(pent-3-en-1-yl)tetrahydro-2H-pyran-2-one |
| Synonyms | Source |
|---|---|
| 6-(pent-3-en-1-yl)oxan-2-one | IUPAC |
| tetrahydro-6-(3-pentenyl)-2H-pyran-2-one | ChemIDplus |
| jasmolactone | ChEBI |
| petal pyranone | ChEBI |
| dec-8-eno-1,5-lactone | ChEBI |
| 8-decen-5-olide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 21229812 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1563500 | Reaxys |
| CAS:32764-98-0 | ChemIDplus |
| Citations |
|---|