EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H14N2O |
| Net Charge | +2 |
| Average Mass | 106.169 |
| Monoisotopic Mass | 106.10952 |
| SMILES | [NH3+]CCC(O)C[NH3+] |
| InChI | InChI=1S/C4H12N2O/c5-2-1-4(7)3-6/h4,7H,1-3,5-6H2/p+2 |
| InChIKey | HXMVNCMPQGPRLN-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyputrescine(2+) (CHEBI:180908) has functional parent 1,4-butanediammonium (CHEBI:326268) |
| 2-hydroxyputrescine(2+) (CHEBI:180908) is a alkane-α,ω-diammonium(2+) (CHEBI:70977) |
| 2-hydroxyputrescine(2+) (CHEBI:180908) is conjugate acid of 2-hydroxyputrescine (CHEBI:180907) |
| Incoming Relation(s) |
| 2-hydroxyputrescine (CHEBI:180907) is conjugate base of 2-hydroxyputrescine(2+) (CHEBI:180908) |
| IUPAC Name |
|---|
| 2-hydroxybutane-1,4-bis(aminium) |
| UniProt Name | Source |
|---|---|
| 2-hydroxyputrescine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20029 | MetaCyc |
| Citations |
|---|