EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H12N2O |
| Net Charge | 0 |
| Average Mass | 104.153 |
| Monoisotopic Mass | 104.09496 |
| SMILES | NCCC(O)CN |
| InChI | InChI=1S/C4H12N2O/c5-2-1-4(7)3-6/h4,7H,1-3,5-6H2 |
| InChIKey | HXMVNCMPQGPRLN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenimonas sp. HX-9-20 (ncbitaxon:2596921) | - | PubMed (32748162) | |
| Pelistega suis (ncbitaxon:1631957) | - | PubMed (26449759) | |
| Rattus norvegicus (ncbitaxon:10116) | brain (BTO:0000142) | PubMed (3335858) | |
| Rhizobacter bergeniae (ncbitaxon:1395940) | - | PubMed (25389149) | Strain: PLGR-1 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyputrescine (CHEBI:180907) has functional parent putrescine (CHEBI:17148) |
| 2-hydroxyputrescine (CHEBI:180907) has role anticonvulsant (CHEBI:35623) |
| 2-hydroxyputrescine (CHEBI:180907) has role bacterial metabolite (CHEBI:76969) |
| 2-hydroxyputrescine (CHEBI:180907) is a alkane-α,ω-diamine (CHEBI:35411) |
| 2-hydroxyputrescine (CHEBI:180907) is a secondary alcohol (CHEBI:35681) |
| 2-hydroxyputrescine (CHEBI:180907) is conjugate base of 2-hydroxyputrescine(2+) (CHEBI:180908) |
| Incoming Relation(s) |
| 2-hydroxyputrescine(2+) (CHEBI:180908) is conjugate acid of 2-hydroxyputrescine (CHEBI:180907) |
| IUPAC Name |
|---|
| 1,4-diaminobutan-2-ol |
| Synonym | Source |
|---|---|
| 1,4-diamino-2-butanol | ChemIDplus |
| Citations |
|---|