EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O6 |
| Net Charge | 0 |
| Average Mass | 376.449 |
| Monoisotopic Mass | 376.18859 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])C[C@@H](O)C2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C21H28O6/c1-19-5-3-11(23)7-14(19)15(24)8-12-13-4-6-21(27,17(26)10-22)20(13,2)9-16(25)18(12)19/h3,5,7,12-13,15-16,18,22,24-25,27H,4,6,8-10H2,1-2H3/t12-,13-,15+,16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | LJGWPGVRXUUNAG-UJXAPRPESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (25800201) |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6β-hydroxyprednisolone (CHEBI:180697) has functional parent prednisolone (CHEBI:8378) |
| 6β-hydroxyprednisolone (CHEBI:180697) has role human urinary metabolite (CHEBI:84087) |
| 6β-hydroxyprednisolone (CHEBI:180697) is a 11β-hydroxy steroid (CHEBI:35346) |
| 6β-hydroxyprednisolone (CHEBI:180697) is a 17α-hydroxy steroid (CHEBI:35342) |
| 6β-hydroxyprednisolone (CHEBI:180697) is a 20-oxo steroid (CHEBI:36885) |
| 6β-hydroxyprednisolone (CHEBI:180697) is a 21-hydroxy steroid (CHEBI:35344) |
| 6β-hydroxyprednisolone (CHEBI:180697) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| 6β-hydroxyprednisolone (CHEBI:180697) is a 6β-hydroxy steroid (CHEBI:36851) |
| 6β-hydroxyprednisolone (CHEBI:180697) is a C21-steroid (CHEBI:61313) |
| 6β-hydroxyprednisolone (CHEBI:180697) is a glucocorticoid (CHEBI:24261) |
| 6β-hydroxyprednisolone (CHEBI:180697) is a primary α-hydroxy ketone (CHEBI:139590) |
| 6β-hydroxyprednisolone (CHEBI:180697) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 6β,11β,17,21-tetrahydroxypregna-1,4-diene-3,20-dione |
| Synonym | Source |
|---|---|
| (1R,3aS,3bS,5R,9aR,9bS,10S,11aS)-1,5,10-trihydroxy-1-(hydroxyacetyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,9a,9b,10,11,11a-dodecahydro-7H-cyclopenta[a]phenanthren-7-one | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:16355-29-6 | ChemIDplus |
| Citations |
|---|