EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O5 |
| Net Charge | 0 |
| Average Mass | 362.466 |
| Monoisotopic Mass | 362.20932 |
| SMILES | [H][C@@]12CC[C@](O)([C@@H](O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h5,7,9,14-18,22,24-26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,16-,17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | LCOVYWIXMAJCDS-FJWDNACWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | urine (BTO:0001419) | PubMed (28806969) | |
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000118) | PubMed (898234) |
| Roles Classification |
|---|
| Biological Roles: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20β-dihydroprednisolone (CHEBI:180696) has functional parent prednisolone (CHEBI:8378) |
| 20β-dihydroprednisolone (CHEBI:180696) has role human metabolite (CHEBI:77746) |
| 20β-dihydroprednisolone (CHEBI:180696) has role mammalian metabolite (CHEBI:75768) |
| 20β-dihydroprednisolone (CHEBI:180696) is a 11β-hydroxy steroid (CHEBI:35346) |
| 20β-dihydroprednisolone (CHEBI:180696) is a 17α-hydroxy steroid (CHEBI:35342) |
| 20β-dihydroprednisolone (CHEBI:180696) is a 20-hydroxy steroid (CHEBI:36854) |
| 20β-dihydroprednisolone (CHEBI:180696) is a 21-hydroxy steroid (CHEBI:35344) |
| 20β-dihydroprednisolone (CHEBI:180696) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| 20β-dihydroprednisolone (CHEBI:180696) is a C21-steroid (CHEBI:61313) |
| 20β-dihydroprednisolone (CHEBI:180696) is a glucocorticoid (CHEBI:24261) |
| IUPAC Name |
|---|
| (20S)-11β,17,20,21-tetrahydroxypregna-1,4-dien-3-one |
| Synonyms | Source |
|---|---|
| (11β,20S)-11,17,20,21-tetrahydroxypregna-1,4-dien-3-one | ChemIDplus |
| (20S)-hydroxyprednisolone | ChEBI |
| 20(S)-hydroxy prednisolone | ChEBI |
| 20β-dihydro-PRED | SUBMITTER |
| 20β-hydroxyprednisolone | ChemIDplus |
| prednisolone EP impurity G | ChEBI |
| Citations |
|---|