EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23ClFNO |
| Net Charge | 0 |
| Average Mass | 347.861 |
| Monoisotopic Mass | 347.14522 |
| SMILES | O[C@@H](CN1CCC(Cc2ccc(F)cc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClFNO/c21-18-5-3-17(4-6-18)20(24)14-23-11-9-16(10-12-23)13-15-1-7-19(22)8-2-15/h1-8,16,20,24H,9-14H2/t20-/m0/s1 |
| InChIKey | GGUSQTSTQSHJAH-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-eliprodil (CHEBI:180648) is a 1-(4-chlorophenyl)-2-[4-(4-fluorobenzyl)piperidin-1-yl]ethanol (CHEBI:180651) |
| (R)-eliprodil (CHEBI:180648) is enantiomer of (S)-eliprodil (CHEBI:180649) |
| Incoming Relation(s) |
| eliprodil (CHEBI:91784) has part (R)-eliprodil (CHEBI:180648) |
| (S)-eliprodil (CHEBI:180649) is enantiomer of (R)-eliprodil (CHEBI:180648) |
| IUPAC Name |
|---|
| (1R)-1-(4-chlorophenyl)-2-[4-(4-fluorobenzyl)piperidin-1-yl]ethanol |
| Synonyms | Source |
|---|---|
| (1R)-1-(4-chlorophenyl)-2-{4-[(4-fluorophenyl)methyl]piperidin-1-yl}ethan-1-ol | IUPAC |
| R-eliprodil | ChEBI |
| (−)-(R)-eliprodil | ChemIDplus |
| (R)-α-(4-chlorophenyl)-4-(4-fluorobenzyl)-1-piperidineethanol | ChEBI |
| (R)-1-(4-chlorophenyl)-2-(4-(4-fluorobenzyl)piperidin-1-yl)ethanol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:127293-57-6 | ChemIDplus |
| Citations |
|---|