EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25F3N2OS.2HCl |
| Net Charge | 0 |
| Average Mass | 507.449 |
| Monoisotopic Mass | 506.11732 |
| SMILES | Cl.Cl.OCCN1CCN(CC/C=C2/c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C23H25F3N2OS.2ClH/c24-23(25,26)17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)30-22)5-3-9-27-10-12-28(13-11-27)14-15-29;;/h1-2,4-8,16,29H,3,9-15H2;2*1H/b18-5-;; |
| InChIKey | IOVDQEIIMOZNNA-MHKBYHAFSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-flupenthixol dihydrochloride (CHEBI:180489) has part cis-flupenthixol(2+) (CHEBI:180488) |
| cis-flupenthixol dihydrochloride (CHEBI:180489) has role geroprotector (CHEBI:176497) |
| cis-flupenthixol dihydrochloride (CHEBI:180489) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-(4-{(3Z)-3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl}piperazin-1-yl)ethanol dihydrochloride |
| Synonyms | Source |
|---|---|
| 2-(4-{(3Z)-3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl}piperazin-1-yl)ethan-1-ol—hydrogen chloride (1/2) | IUPAC |
| ChEBI | |
| (Z)-flupenthixol dihydrochloride | ChEBI |
| cis-(Z)-flupenthixol dihydrochloride | ChEBI |
| 1-(2-hydroxyethyl)-4-{(3Z)-3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl}piperazinediium dichloride | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 4445626 | ChemSpider |
| Citations |
|---|