EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27F3N2OS |
| Net Charge | +2 |
| Average Mass | 436.543 |
| Monoisotopic Mass | 436.17852 |
| SMILES | OCC[NH+]1CC[NH+](CC/C=C2/c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C23H25F3N2OS/c24-23(25,26)17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)30-22)5-3-9-27-10-12-28(13-11-27)14-15-29/h1-2,4-8,16,29H,3,9-15H2/p+2/b18-5- |
| InChIKey | NJMYODHXAKYRHW-DVZOWYKESA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-flupenthixol(2+) (CHEBI:180488) is a tertiary ammonium ion (CHEBI:137982) |
| cis-flupenthixol(2+) (CHEBI:180488) is conjugate acid of cis-flupenthixol (CHEBI:10454) |
| Incoming Relation(s) |
| cis-flupenthixol dihydrochloride (CHEBI:180489) has part cis-flupenthixol(2+) (CHEBI:180488) |
| cis-flupenthixol (CHEBI:10454) is conjugate base of cis-flupenthixol(2+) (CHEBI:180488) |
| IUPAC Name |
|---|
| 1-(2-hydroxyethyl)-4-{(3Z)-3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl}piperazinediium |
| Synonyms | Source |
|---|---|
| 1-(2-hydroxyethyl)-4-{(3Z)-3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl}piperazine-1,4-diium | IUPAC |
| cis-flupenthixol dication | ChEBI |
| cis-(Z)-flupenthixol dication | ChEBI |
| (Z)-flupenthixol dication | ChEBI |