EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O2S2 |
| Net Charge | 0 |
| Average Mass | 208.348 |
| Monoisotopic Mass | 208.05917 |
| SMILES | O=C(O)CCCCC(S)CCS |
| InChI | InChI=1S/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10) |
| InChIKey | IZFHEQBZOYJLPK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrolipoic acid (CHEBI:18047) has functional parent octanoic acid (CHEBI:28837) |
| dihydrolipoic acid (CHEBI:18047) has role antioxidant (CHEBI:22586) |
| dihydrolipoic acid (CHEBI:18047) has role human metabolite (CHEBI:77746) |
| dihydrolipoic acid (CHEBI:18047) has role neuroprotective agent (CHEBI:63726) |
| dihydrolipoic acid (CHEBI:18047) is a thio-fatty acid (CHEBI:59913) |
| dihydrolipoic acid (CHEBI:18047) is conjugate acid of dihydrolipoate (CHEBI:30316) |
| Incoming Relation(s) |
| (R)-dihydrolipoic acid (CHEBI:45230) is a dihydrolipoic acid (CHEBI:18047) |
| (S)-dihydrolipoic acid (CHEBI:30318) is a dihydrolipoic acid (CHEBI:18047) |
| dihydrolipoate (CHEBI:30316) is conjugate base of dihydrolipoic acid (CHEBI:18047) |
| IUPAC Name |
|---|
| 6,8-disulfanyloctanoic acid |
| Synonyms | Source |
|---|---|
| 6,8-bis-sulfanyloctanoic acid | ChEBI |
| 6,8-Dihydrothioctic acid | ChemIDplus |
| 6,8-dimercapto-octanoic acid | ChEBI |
| 6,8-dimercaptooctanoic acid | ChemIDplus |
| DHLA | ChEBI |
| dihydro-lipoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02147 | KEGG COMPOUND |
| DB03760 | DrugBank |
| Dihydrolipoic_acid | Wikipedia |
| HMDB0012210 | HMDB |
| Citations |
|---|