EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O5 |
| Net Charge | 0 |
| Average Mass | 484.677 |
| Monoisotopic Mass | 484.31887 |
| SMILES | [H][C@]1([C@H](C)C[C@H](O)/C=C(\C)C(=O)O)CC[C@@]2(C)C3=C(CC[C@@]21C)[C@@]1(C)CCC(=O)C(C)(C)C1CC3=O |
| InChI | InChI=1S/C30H44O5/c1-17(14-19(31)15-18(2)26(34)35)20-8-13-30(7)25-21(9-12-29(20,30)6)28(5)11-10-24(33)27(3,4)23(28)16-22(25)32/h15,17,19-20,23,31H,8-14,16H2,1-7H3,(H,34,35)/b18-15+/t17-,19+,20-,23?,28-,29-,30+/m1/s1 |
| InChIKey | WCPRSKXCWMBEHO-DLDLXSDHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma hainanense (ncbitaxon:5314) | fruit body (BTO:0000487) | DOI (10.1016/j.phytochem.2014.10.009) | |
| Ganoderma lucidum (ncbitaxon:5315) | - | PubMed (30077898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hainanic acid A (CHEBI:180457) has role fungal metabolite (CHEBI:76946) |
| hainanic acid A (CHEBI:180457) is a 14α-methyl steroid (CHEBI:138029) |
| hainanic acid A (CHEBI:180457) is a 23-hydroxy steroid (CHEBI:36866) |
| hainanic acid A (CHEBI:180457) is a 3-oxo steroid (CHEBI:47788) |
| hainanic acid A (CHEBI:180457) is a 7-oxo steroid (CHEBI:47789) |
| hainanic acid A (CHEBI:180457) is a dioxo monocarboxylic acid (CHEBI:35951) |
| hainanic acid A (CHEBI:180457) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| hainanic acid A (CHEBI:180457) is a lanostane sterol (CHEBI:131637) |
| hainanic acid A (CHEBI:180457) is a steroid acid (CHEBI:47891) |
| hainanic acid A (CHEBI:180457) is a tetracyclic triterpenoid (CHEBI:26893) |
| hainanic acid A (CHEBI:180457) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| hainanic acid A (CHEBI:180457) is conjugate acid of hainanate A (CHEBI:178027) |
| Incoming Relation(s) |
| hainanate A (CHEBI:178027) is conjugate base of hainanic acid A (CHEBI:180457) |
| IUPAC Name |
|---|
| (5ξ,23S,24E)-23-hydroxy-3,7-dioxolanosta-8,24-dien-26-oic acid |
| Synonym | Source |
|---|---|
| (+)-hainanic acid A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 78442029 | ChemSpider |
| Citations |
|---|