EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO |
| Net Charge | 0 |
| Average Mass | 73.095 |
| Monoisotopic Mass | 73.05276 |
| SMILES | CC(=O)CN |
| InChI | InChI=1S/C3H7NO/c1-3(5)2-4/h2,4H2,1H3 |
| InChIKey | BCDGQXUMWHRQCB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminoacetone (CHEBI:17906) has functional parent acetone (CHEBI:15347) |
| aminoacetone (CHEBI:17906) has role Escherichia coli metabolite (CHEBI:76971) |
| aminoacetone (CHEBI:17906) has role mouse metabolite (CHEBI:75771) |
| aminoacetone (CHEBI:17906) is a methyl ketone (CHEBI:51867) |
| aminoacetone (CHEBI:17906) is a propanones (CHEBI:26292) |
| aminoacetone (CHEBI:17906) is conjugate base of ammonioacetone (CHEBI:58320) |
| Incoming Relation(s) |
| ammonioacetone (CHEBI:58320) is conjugate acid of aminoacetone (CHEBI:17906) |
| IUPAC Name |
|---|
| 1-aminopropan-2-one |
| Synonyms | Source |
|---|---|
| 1-Amino-2-propanone | KEGG COMPOUND |
| 1-AMINO-PROPAN-2-ONE | PDBeChem |
| Aminoacetone | KEGG COMPOUND |