EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO |
| Net Charge | 0 |
| Average Mass | 161.204 |
| Monoisotopic Mass | 161.08406 |
| SMILES | OCCc1cnc2ccccc12 |
| InChI | InChI=1S/C10H11NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,7,11-12H,5-6H2 |
| InChIKey | MBBOMCVGYCRMEA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. auxin Any of a group of compounds, both naturally occurring and synthetic, that induce cell elongation in plant stems (from Greek αυξανω, "to grow"). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tryptophol (CHEBI:17890) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| tryptophol (CHEBI:17890) has role auxin (CHEBI:22676) |
| tryptophol (CHEBI:17890) has role plant metabolite (CHEBI:76924) |
| tryptophol (CHEBI:17890) is a indolyl alcohol (CHEBI:38467) |
| Incoming Relation(s) |
| tryptophol-2-sulfonic acid (CHEBI:147413) has functional parent tryptophol (CHEBI:17890) |
| IUPAC Name |
|---|
| 2-(1H-indol-3-yl)ethanol |
| Synonyms | Source |
|---|---|
| 1H-indole-3-ethanol | NIST Chemistry WebBook |
| 1H-indolyl-3-ethanol | NIST Chemistry WebBook |
| 2-(indol-3-yl)ethanol | ChEBI |
| 3-(2-hydroxyethyl)indole | ChemIDplus |
| Indole-3-ethanol | KEGG COMPOUND |
| Tryptophanol | HMDB |
| UniProt Name | Source |
|---|---|
| indole-3-ethanol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000114 | KNApSAcK |
| C00955 | KEGG COMPOUND |
| C00955 | KEGG COMPOUND |
| CPD-341 | MetaCyc |
| HMDB0003447 | HMDB |
| Tryptophol | Wikipedia |
| Citations |
|---|