EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO4S |
| Net Charge | 0 |
| Average Mass | 241.268 |
| Monoisotopic Mass | 241.04088 |
| SMILES | O=S(=O)(O)c1nc2ccccc2c1CCO |
| InChI | InChI=1S/C10H11NO4S/c12-6-5-8-7-3-1-2-4-9(7)11-10(8)16(13,14)15/h1-4,11-12H,5-6H2,(H,13,14,15) |
| InChIKey | ZYURVYKNOZACDY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitis vinifera (ncbitaxon:29760) | Wine (NCIT:C66822) | PubMed (29339827) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tryptophol-2-sulfonic acid (CHEBI:147413) has functional parent tryptophol (CHEBI:17890) |
| tryptophol-2-sulfonic acid (CHEBI:147413) has role plant metabolite (CHEBI:76924) |
| tryptophol-2-sulfonic acid (CHEBI:147413) is a indolyl alcohol (CHEBI:38467) |
| tryptophol-2-sulfonic acid (CHEBI:147413) is a organosulfonic acid (CHEBI:33551) |
| IUPAC Name |
|---|
| 3-(2-hydroxyethyl)-1H-indole-2-sulfonic acid |
| Synonym | Source |
|---|---|
| TOL-SO3H | ChEBI |
| Citations |
|---|