EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H25N3O4 |
| Net Charge | 0 |
| Average Mass | 251.327 |
| Monoisotopic Mass | 251.18451 |
| SMILES | NC[C@H](O)C[C@H](O)CNC[C@@H](O)C[C@@H](O)CN |
| InChI | InChI=1S/C10H25N3O4/c11-3-7(14)1-9(16)5-13-6-10(17)2-8(15)4-12/h7-10,13-17H,1-6,11-12H2/t7-,8-,9+,10+/m1/s1 |
| InChIKey | CVHXLYVSUFLGEI-IMSYWVGJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-pavettamine (CHEBI:178110) is a amino alcohol (CHEBI:22478) |
| ent-pavettamine (CHEBI:178110) is a primary amino compound (CHEBI:50994) |
| ent-pavettamine (CHEBI:178110) is a secondary alcohol (CHEBI:35681) |
| ent-pavettamine (CHEBI:178110) is a secondary amino compound (CHEBI:50995) |
| ent-pavettamine (CHEBI:178110) is a tetrol (CHEBI:33573) |
| ent-pavettamine (CHEBI:178110) is a triamine (CHEBI:38751) |
| ent-pavettamine (CHEBI:178110) is enantiomer of pavettamine (CHEBI:178009) |
| Incoming Relation(s) |
| pavettamine (CHEBI:178009) is enantiomer of ent-pavettamine (CHEBI:178110) |
| IUPAC Name |
|---|
| (2R,4S,2'R,4'S)-5,5'-iminobis(1-aminopentane-2,4-diol) |
| Synonym | Source |
|---|---|
| (2R,4S,2'R,4'S)-5,5'-azanediylbis(1-aminopentane-2,4-diol) | IUPAC |
| Citations |
|---|