EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H25N3O4 |
| Net Charge | 0 |
| Average Mass | 251.327 |
| Monoisotopic Mass | 251.18451 |
| SMILES | NC[C@@H](O)C[C@@H](O)CNC[C@H](O)C[C@H](O)CN |
| InChI | InChI=1S/C10H25N3O4/c11-3-7(14)1-9(16)5-13-6-10(17)2-8(15)4-12/h7-10,13-17H,1-6,11-12H2/t7-,8-,9+,10+/m0/s1 |
| InChIKey | CVHXLYVSUFLGEI-AXTSPUMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fadogia homblei (ncbitaxon:980240) | - | PubMed (8600441) | |
| Pavetta harborii (ncbitaxon:980241) | leaf (BTO:0000713) | PubMed (8600441) | |
| Pavetta schumanniana (ncbitaxon:992771) | - | PubMed (8600441) | |
| Psychotria punctata (ncbitaxon:180039) | - | PubMed (34395523) | |
| Vangueria pygmaea (ncbitaxon:164483) | - | PubMed (8600441) | Species also known as Pachystigma pygmaeum. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. cardiotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the heart and cardiomyocytes. phytotoxin Any toxin produced by a plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pavettamine (CHEBI:178009) has role cardiotoxic agent (CHEBI:50912) |
| pavettamine (CHEBI:178009) has role phytotoxin (CHEBI:38231) |
| pavettamine (CHEBI:178009) has role protein synthesis inhibitor (CHEBI:48001) |
| pavettamine (CHEBI:178009) is a amino alcohol (CHEBI:22478) |
| pavettamine (CHEBI:178009) is a primary amino compound (CHEBI:50994) |
| pavettamine (CHEBI:178009) is a secondary alcohol (CHEBI:35681) |
| pavettamine (CHEBI:178009) is a secondary amino compound (CHEBI:50995) |
| pavettamine (CHEBI:178009) is a tetrol (CHEBI:33573) |
| pavettamine (CHEBI:178009) is a triamine (CHEBI:38751) |
| pavettamine (CHEBI:178009) is enantiomer of ent-pavettamine (CHEBI:178110) |
| Incoming Relation(s) |
| ent-pavettamine (CHEBI:178110) is enantiomer of pavettamine (CHEBI:178009) |
| IUPAC Name |
|---|
| (2R,4S,2'R,4'S)-1,1'-iminobis(5-aminopentane-2,4-diol) |
| Synonyms | Source |
|---|---|
| (2R,4S,2'R,4'S)-1,1'-azanediylbis(5-aminopentane-2,4-diol) | IUPAC |
| pavetamine | ChEBI |
| Citations |
|---|