EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H2D4O3 |
| Net Charge | 0 |
| Average Mass | 142.146 |
| Monoisotopic Mass | 142.05680 |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)O)c(O)c1[2H] |
| InChI | InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10)/i1D,2D,3D,4D |
| InChIKey | YGSDEFSMJLZEOE-RHQRLBAQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2187) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salicylic acid-d4 (CHEBI:178057) has functional parent salicylic acid (CHEBI:16914) |
| salicylic acid-d4 (CHEBI:178057) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2,3,4,5-tetradeuterio-6-hydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23977006 | ChemSpider |