EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30IN5O |
| Net Charge | 0 |
| Average Mass | 567.475 |
| Monoisotopic Mass | 567.14951 |
| SMILES | [N-]=[N+]=Nc1ccc(CCN2CCN(CCOC(c3ccccc3)c3ccccc3)CC2)cc1I |
| InChI | InChI=1S/C27H30IN5O/c28-25-21-22(11-12-26(25)30-31-29)13-14-32-15-17-33(18-16-32)19-20-34-27(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-12,21,27H,13-20H2 |
| InChIKey | FXEDECJAXCCXOU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(2-(diphenylmethoxy)ethyl)-4-(2-(4-azido-3-iodophenyl)ethyl)piperazine (CHEBI:177883) has role dopamine uptake inhibitor (CHEBI:51039) |
| 1-(2-(diphenylmethoxy)ethyl)-4-(2-(4-azido-3-iodophenyl)ethyl)piperazine (CHEBI:177883) is a N-alkylpiperazine (CHEBI:46845) |
| 1-(2-(diphenylmethoxy)ethyl)-4-(2-(4-azido-3-iodophenyl)ethyl)piperazine (CHEBI:177883) is a azide (CHEBI:22680) |
| 1-(2-(diphenylmethoxy)ethyl)-4-(2-(4-azido-3-iodophenyl)ethyl)piperazine (CHEBI:177883) is a ether (CHEBI:25698) |
| 1-(2-(diphenylmethoxy)ethyl)-4-(2-(4-azido-3-iodophenyl)ethyl)piperazine (CHEBI:177883) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 1-[2-(4-azido-3-iodophenyl)ethyl]-4-[2-(diphenylmethoxy)ethyl]piperazine |
| Synonyms | Source |
|---|---|
| 1-[2-(4-azido-3-iodophenyl)ethyl]-4-(2-benzhydryloxyethyl)piperazine | ChEBI |
| 1-[2-(benzhydryloxy)ethyl]-4-(3-iodo-4-azidophenethyl)piperazine | ChEBI |
| DEEP | ChEBI |
| I-Deep | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 19982466 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:123632-48-4 | ChemIDplus |
| Citations |
|---|