EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO3 |
| Net Charge | 0 |
| Average Mass | 173.212 |
| Monoisotopic Mass | 173.10519 |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-5(2)4-7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t7-/m0/s1 |
| InChIKey | WXNXCEHXYPACJF-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS88) | ||
| - | MetaboLights (MTBLS125) | ||
| - | DOI (10.1371/journal.pone.0115359) | ||
| - | MetaboLights (MTBLS87) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-leucine (CHEBI:17786) has role metabolite (CHEBI:25212) |
| N-acetyl-L-leucine (CHEBI:17786) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-leucine (CHEBI:17786) is a L-leucine derivative (CHEBI:25018) |
| N-acetyl-L-leucine (CHEBI:17786) is conjugate acid of N-acetyl-L-leucinate (CHEBI:58270) |
| N-acetyl-L-leucine (CHEBI:17786) is enantiomer of N-acetyl-D-leucine (CHEBI:146296) |
| Incoming Relation(s) |
| N-acetyl-L-leucinate (CHEBI:58270) is conjugate base of N-acetyl-L-leucine (CHEBI:17786) |
| N-acetyl-D-leucine (CHEBI:146296) is enantiomer of N-acetyl-L-leucine (CHEBI:17786) |
| N-terminal N-acetyl-L-leucyl residue (CHEBI:194223) is substituent group from N-acetyl-L-leucine (CHEBI:17786) |
| IUPAC Names |
|---|
| N-acetyl-L-leucine |
| (2S)-2-(acetylamino)-4-methylpentanoic acid |
| N-acetylleucine |
| Synonyms | Source |
|---|---|
| N-Acetyl-L-leucine | KEGG COMPOUND |
| acetylleucine | ChemIDplus |
| N-acetyl-Leu | NIST Chemistry WebBook |
| N-acetylleucine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02710 | KEGG COMPOUND |
| HMDB0011756 | HMDB |
| Acetylleucine | Wikipedia |
| CPD-433 | MetaCyc |
| 1918 | ChemSpider |
| LSM-20975 | LINCS |
| Citations |
|---|