EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO3 |
| Net Charge | 0 |
| Average Mass | 173.212 |
| Monoisotopic Mass | 173.10519 |
| SMILES | CC(=O)N[C@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-5(2)4-7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t7-/m1/s1 |
| InChIKey | WXNXCEHXYPACJF-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-D-leucine (CHEBI:146296) is a N-acetyl-D-amino acid (CHEBI:21501) |
| N-acetyl-D-leucine (CHEBI:146296) is a D-leucine derivative (CHEBI:84114) |
| N-acetyl-D-leucine (CHEBI:146296) is conjugate acid of N-acetyl-D-leucinate (CHEBI:145946) |
| N-acetyl-D-leucine (CHEBI:146296) is enantiomer of N-acetyl-L-leucine (CHEBI:17786) |
| Incoming Relation(s) |
| N-acetyl-D-leucinate (CHEBI:145946) is conjugate base of N-acetyl-D-leucine (CHEBI:146296) |
| N-acetyl-L-leucine (CHEBI:17786) is enantiomer of N-acetyl-D-leucine (CHEBI:146296) |
| IUPAC Name |
|---|
| N-acetyl-D-leucine |
| Synonyms | Source |
|---|---|
| (2R)-2-acetamido-4-methylpentanoic acid | IUPAC |
| N-acetyl-R-leucine | ChemIDplus |
| N-acetyl-D-Leu | ChEBI |
| (R)-acetylleucine | ChemIDplus |
| D-acetylleucine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-5235 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:19764-30-8 | ChemIDplus |
| Citations |
|---|