EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20ClN5O.HCl |
| Net Charge | 0 |
| Average Mass | 442.350 |
| Monoisotopic Mass | 441.11232 |
| SMILES | Cl.N#Cc1ccc(Cn2cncc2CN2CCN(c3cccc(Cl)c3)C(=O)C2)cc1 |
| InChI | InChI=1S/C22H20ClN5O.ClH/c23-19-2-1-3-20(10-19)28-9-8-26(15-22(28)29)14-21-12-25-16-27(21)13-18-6-4-17(11-24)5-7-18;/h1-7,10,12,16H,8-9,13-15H2;1H |
| InChIKey | YNBSQYGTJLIPJS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.5.1.59 (protein geranylgeranyltransferase type I) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein geranylgeranyltransferase type I (EC 2.5.1.59). EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-778,123 hydrochloride (CHEBI:177371) has part L-778,123 (free base) (CHEBI:180478) |
| L-778,123 hydrochloride (CHEBI:177371) has role antineoplastic agent (CHEBI:35610) |
| L-778,123 hydrochloride (CHEBI:177371) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| L-778,123 hydrochloride (CHEBI:177371) has role EC 2.5.1.59 (protein geranylgeranyltransferase type I) inhibitor (CHEBI:67267) |
| L-778,123 hydrochloride (CHEBI:177371) has role radiosensitizing agent (CHEBI:132992) |
| L-778,123 hydrochloride (CHEBI:177371) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-[(5-{[4-(3-chlorophenyl)-3-oxopiperazin-1-yl]methyl}-1H-imidazol-1-yl)methyl]benzonitrile hydrochloride |
| Synonyms | Source |
|---|---|
| L-778,123 hydrochloride | SUBMITTER |
| L-778123 hydrochloride | SUBMITTER |
| L-778123 | ChemIDplus |
| L 778123 | ChemIDplus |
| L 778,123 | ChemIDplus |
| L778123 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 187600 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:253863-00-2 | ChemIDplus |
| Citations |
|---|