EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20ClN5O.HCl |
| Net Charge | 0 |
| Average Mass | 442.350 |
| Monoisotopic Mass | 441.11232 |
| SMILES | Cl.N#Cc1ccc(Cn2cncc2CN2CCN(c3cccc(Cl)c3)C(=O)C2)cc1 |
| InChI | InChI=1S/C22H20ClN5O.ClH/c23-19-2-1-3-20(10-19)28-9-8-26(15-22(28)29)14-21-12-25-16-27(21)13-18-6-4-17(11-24)5-7-18;/h1-7,10,12,16H,8-9,13-15H2;1H |
| InChIKey | YNBSQYGTJLIPJS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. EC 2.5.1.59 (protein geranylgeranyltransferase type I) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein geranylgeranyltransferase type I (EC 2.5.1.59). |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-778,123 hydrochloride (CHEBI:177371) has part L-778,123 (free base) (CHEBI:180478) |
| L-778,123 hydrochloride (CHEBI:177371) has role antineoplastic agent (CHEBI:35610) |
| L-778,123 hydrochloride (CHEBI:177371) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| L-778,123 hydrochloride (CHEBI:177371) has role EC 2.5.1.59 (protein geranylgeranyltransferase type I) inhibitor (CHEBI:67267) |
| L-778,123 hydrochloride (CHEBI:177371) has role radiosensitizing agent (CHEBI:132992) |
| L-778,123 hydrochloride (CHEBI:177371) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-[(5-{[4-(3-chlorophenyl)-3-oxopiperazin-1-yl]methyl}-1H-imidazol-1-yl)methyl]benzonitrile hydrochloride |
| Synonyms | Source |
|---|---|
| L 778,123 | ChemIDplus |
| L 778123 | ChemIDplus |
| L-778,123 | ChEBI |
| L-778123 | ChemIDplus |
| L778123 | ChemIDplus |
| L-778,123 HCl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 187600 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:253863-00-2 | ChemIDplus |
| Citations |
|---|