EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N4O |
| Net Charge | 0 |
| Average Mass | 320.396 |
| Monoisotopic Mass | 320.16371 |
| SMILES | NC(=O)c1cccc2cn(-c3ccc(C4CCCNC4)cc3)nc12 |
| InChI | InChI=1S/C19H20N4O/c20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14/h1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24) |
| InChIKey | PCHKPVIQAHNQLW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of a NAD+ ADP-ribosyltransferase (EC 2.4.2.30). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide (CHEBI:177298) has role antineoplastic agent (CHEBI:35610) |
| 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide (CHEBI:177298) has role EC 2.4.2.30 (NAD+ ADP-ribosyltransferase) inhibitor (CHEBI:62913) |
| 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide (CHEBI:177298) is a benzenes (CHEBI:22712) |
| 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide (CHEBI:177298) is a indazoles (CHEBI:38769) |
| 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide (CHEBI:177298) is a piperidines (CHEBI:26151) |
| 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide (CHEBI:177298) is a primary carboxamide (CHEBI:140324) |
| Incoming Relation(s) |
| 2-{4-[(3R)-piperidin-3-yl]phenyl}-2H-indazole-7-carboxamide (CHEBI:177299) is a 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide (CHEBI:177298) |
| niraparib (CHEBI:176844) is a 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide (CHEBI:177298) |
| IUPAC Name |
|---|
| 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide |
| Citations |
|---|