EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N4O |
| Net Charge | 0 |
| Average Mass | 320.396 |
| Monoisotopic Mass | 320.16371 |
| SMILES | [H][C@@]1(c2ccc(-n3cc4cccc(C(N)=O)c4n3)cc2)CCCNC1 |
| InChI | InChI=1S/C19H20N4O/c20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14/h1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24)/t14-/m1/s1 |
| InChIKey | PCHKPVIQAHNQLW-CQSZACIVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of a NAD+ ADP-ribosyltransferase (EC 2.4.2.30). EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of a NAD+ ADP-ribosyltransferase (EC 2.4.2.30). |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| niraparib (CHEBI:176844) has role antineoplastic agent (CHEBI:35610) |
| niraparib (CHEBI:176844) has role apoptosis inducer (CHEBI:68495) |
| niraparib (CHEBI:176844) has role EC 2.4.2.30 (NAD+ ADP-ribosyltransferase) inhibitor (CHEBI:62913) |
| niraparib (CHEBI:176844) has role radiosensitizing agent (CHEBI:132992) |
| niraparib (CHEBI:176844) is a 2-[4-(piperidin-3-yl)phenyl]-2H-indazole-7-carboxamide (CHEBI:177298) |
| IUPAC Name |
|---|
| 2-{4-[(3S)-piperidin-3-yl]phenyl}-2H-indazole-7-carboxamide |
| INNs | Source |
|---|---|
| niraparib | WHO MedNet |
| niraparib | WHO MedNet |
| niraparib | WHO MedNet |
| niraparibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-[4-(3S)-3-piperidinylphenyl]-2H-indazole-7-carboxamide | ChEBI |
| 2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide | ChEBI |
| MK 4827 | ChemIDplus |
| MK-4827 | SUBMITTER |
| MK4827 | ChEBI |
| Brand Name | Source |
|---|---|
| Zejula | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1038915-60-4 | ChemIDplus |
| Citations |
|---|