EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12Cl4N4Ru.Na |
| Net Charge | 0 |
| Average Mass | 502.150 |
| Monoisotopic Mass | 500.87573 |
| SMILES | [Cl][Ru-3]([Cl])([Cl])([Cl])([n+]1cc2ccccc2n1)[n+]1cc2ccccc2n1.[Na+] |
| InChI | InChI=1S/2C7H6N2.4ClH.Na.Ru/c2*1-2-4-7-6(3-1)5-8-9-7;;;;;;/h2*1-5H,(H,8,9);4*1H;;/q;;;;;;+1;+3/p-4 |
| InChIKey | WVVOCRYXBTVDRN-UHFFFAOYSA-J |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KP1339 (CHEBI:176975) has role antineoplastic agent (CHEBI:35610) |
| KP1339 (CHEBI:176975) has role apoptosis inducer (CHEBI:68495) |
| KP1339 (CHEBI:176975) is a ruthenium coordination entity (CHEBI:35733) |
| IUPAC Name |
|---|
| sodium tetrachloro[bis(1H-indazole-κN2)]ruthenate(1−) |
| Synonyms | Source |
|---|---|
| BOLD-100 | SUBMITTER |
| IT-139 | SUBMITTER |
| NKP-1339 | SUBMITTER |
| sodium trans-[tetrachloridobis(1H-indazole)ruthenate(III)] | ChEBI |
| KP-1339 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:197723-00-5 | ChemIDplus |
| Citations |
|---|