EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29NO2.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 477.554 |
| Monoisotopic Mass | 477.23627 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)C(=O)O.Oc1ccc2c(c1)[C@@]13CCCC[C@@]1(O)[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C21H29NO2.C4H6O6/c23-17-7-6-16-12-19-21(24)9-2-1-8-20(21,18(16)13-17)10-11-22(19)14-15-4-3-5-15;5-1(3(7)8)2(6)4(9)10/h6-7,13,15,19,23-24H,1-5,8-12,14H2;1-2,5-6H,(H,7,8)(H,9,10)/t19-,20+,21-;1-,2-/m10/s1 |
| InChIKey | GMTYREVWZXJPLF-AFHUBHILSA-N |
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butorphanol D-tartrate (CHEBI:3243) has part butorphanol (CHEBI:3242) |
| butorphanol D-tartrate (CHEBI:3243) has role opioid analgesic (CHEBI:35482) |
| butorphanol D-tartrate (CHEBI:3243) has role κ-opioid receptor agonist (CHEBI:59282) |
| butorphanol D-tartrate (CHEBI:3243) has role μ-opioid receptor agonist (CHEBI:55322) |
| butorphanol D-tartrate (CHEBI:3243) is a morphinane alkaloid (CHEBI:25418) |
| butorphanol D-tartrate (CHEBI:3243) is a tartrate salt (CHEBI:50562) |
| IUPAC Name |
|---|
| 17-(cyclobutylmethyl)morphinan-3,14-diol (2S,3S)-2,3-dihydroxybutanedioate |
| Synonyms | Source |
|---|---|
| (−)-17-(cyclobutylmethyl)morphinan-3,14-diol D-(−)-tartrate | ChemIDplus |
| 17-(cyclobutylmethyl)morphinan-3,14-diyl [S-(R*,R*)]-2,3-dihydroxysuccinate | ChemIDplus |
| butorphanol (S,S)-tartrate | ChEBI |
| butorphanol D-tartrate | ChEBI |
| butorphanol (−)-tartrate | ChEBI |
| (−)-N-cyclobutylmethyl-3,14-dihydroxymorphinan D-(−)-tartrate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5234837 | Beilstein |
| CAS:58786-99-5 | ChemIDplus |
| CAS:58786-99-5 | KEGG DRUG |