EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C/C1=C\CC[C@@](C)(O)/C=C/[C@H](C(C)C)CC1 |
| InChI | InChI=1S/C15H26O/c1-12(2)14-8-7-13(3)6-5-10-15(4,16)11-9-14/h6,9,11-12,14,16H,5,7-8,10H2,1-4H3/b11-9+,13-6+/t14-,15-/m1/s1 |
| InChIKey | RHCTXHCNRLCYBN-QPDMSNBJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hindsii (ncbitaxon:159041) | leaf (BTO:0000713) | DOI (10.1002/ffj.3258) | Species also known as Fortunella hindsii. |
| Citrus japonica (ncbitaxon:76966) | leaf (BTO:0000713) | DOI (10.1002/ffj.3258) | Species also known as Fortunella japonica. |
| Citrus japonica var. margarita (ncbitaxon:85437) | leaf (BTO:0000713) | DOI (10.1002/ffj.3258) | Species also known as Fortunella margarita. |
| Fortunella crassifolia (IPNI:773636-1) | leaf (BTO:0000713) | DOI (10.1002/ffj.3258) | |
| Fortunella obovata (IPNI:773641-1) | leaf (BTO:0000713) | DOI (10.1002/ffj.3258) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| germacra-1(10),5-dien-4α-ol (CHEBI:176847) has role plant metabolite (CHEBI:76924) |
| germacra-1(10),5-dien-4α-ol (CHEBI:176847) is a 1(10),5-germacradien-4-ol (CHEBI:172933) |
| IUPAC Name |
|---|
| (1R,2E,4S,7E)-1,7-dimethyl-4-(propan-2-yl)cyclodeca-2,7-dien-1-ol |
| Synonyms | Source |
|---|---|
| trans-1,7-dimethyl-4-isopropyl-2,7-cyclodeca-2(E),7(E)-dien-1-ol | ChEBI |
| trans-1,7-dimethyl-4-isopropyl-2(E),7(E)-cyclodecadien-1-ol | ChEBI |