EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C/C1=C\CCC(C)(O)/C=C/[C@H](C(C)C)CC1 |
| InChI | InChI=1S/C15H26O/c1-12(2)14-8-7-13(3)6-5-10-15(4,16)11-9-14/h6,9,11-12,14,16H,5,7-8,10H2,1-4H3/b11-9+,13-6+/t14-,15?/m1/s1 |
| InChIKey | RHCTXHCNRLCYBN-PIJLWOHPSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1(10),5-germacradien-4-ol (CHEBI:172933) has role volatile oil component (CHEBI:27311) |
| 1(10),5-germacradien-4-ol (CHEBI:172933) is a carbocyclic compound (CHEBI:33598) |
| 1(10),5-germacradien-4-ol (CHEBI:172933) is a sesquiterpenoid (CHEBI:26658) |
| 1(10),5-germacradien-4-ol (CHEBI:172933) is a tertiary allylic alcohol (CHEBI:134397) |
| Incoming Relation(s) |
| germacra-1(10),5-dien-4α-ol (CHEBI:176847) is a 1(10),5-germacradien-4-ol (CHEBI:172933) |
| germacra-1(10),5-dien-4β-ol (CHEBI:176846) is a 1(10),5-germacradien-4-ol (CHEBI:172933) |
| IUPAC Name |
|---|
| (2E,4S,7E)-1,7-dimethyl-4-(propan-2-yl)cyclodeca-2,7-dien-1-ol |
| Synonym | Source |
|---|---|
| germacra-1(10),5-dien-4-ol | ChEBI |
| Citations |
|---|