EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO6 |
| Net Charge | 0 |
| Average Mass | 311.334 |
| Monoisotopic Mass | 311.13689 |
| SMILES | C/C(=C/C/C=C(\C)C(=O)O)[C@H]1CN[C@H](C(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C15H21NO6/c1-8(4-3-5-9(2)14(19)20)11-7-16-13(15(21)22)10(11)6-12(17)18/h4-5,10-11,13,16H,3,6-7H2,1-2H3,(H,17,18)(H,19,20)(H,21,22)/b8-4-,9-5+/t10-,11+,13-/m0/s1 |
| InChIKey | DDAJBUQQWFXHDM-UUYKTWPLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondria armata (ncbitaxon:860625) | - | PubMed (29321590) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isodomoic acid A (CHEBI:176782) has role algal metabolite (CHEBI:84735) |
| isodomoic acid A (CHEBI:176782) has role marine metabolite (CHEBI:76507) |
| isodomoic acid A (CHEBI:176782) is a L-proline derivative (CHEBI:84186) |
| isodomoic acid A (CHEBI:176782) is a olefinic compound (CHEBI:78840) |
| isodomoic acid A (CHEBI:176782) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| isodomoic acid A (CHEBI:176782) is a tricarboxylic acid (CHEBI:27093) |
| isodomoic acid A (CHEBI:176782) is conjugate acid of isodomoate A(2−) (CHEBI:172367) |
| Incoming Relation(s) |
| isodomoate A(2−) (CHEBI:172367) is conjugate base of isodomoic acid A (CHEBI:176782) |
| IUPAC Name |
|---|
| (3S,4S)-4-[(2Z,5E)-6-carboxyhepta-2,5-dien-2-yl]-3-(carboxymethyl)-L-proline |
| Synonym | Source |
|---|---|
| (2S,3S,4S)-4-[(2Z,5E)-6-carboxyhepta-2,5-dien-2-yl]-3-(carboxymethyl)pyrrolidine-2-carboxylic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:101899-44-9 | ChemIDplus |
| Citations |
|---|