EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO6 |
| Net Charge | -2 |
| Average Mass | 309.318 |
| Monoisotopic Mass | 309.12233 |
| SMILES | C/C(=C/C/C=C(\C)C(=O)[O-])[C@H]1C[NH2+][C@H](C(=O)[O-])[C@H]1CC(=O)[O-] |
| InChI | InChI=1S/C15H21NO6/c1-8(4-3-5-9(2)14(19)20)11-7-16-13(15(21)22)10(11)6-12(17)18/h4-5,10-11,13,16H,3,6-7H2,1-2H3,(H,17,18)(H,19,20)(H,21,22)/p-2/b8-4-,9-5+/t10-,11+,13-/m0/s1 |
| InChIKey | DDAJBUQQWFXHDM-UUYKTWPLSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isodomoate A(2−) (CHEBI:172367) is a tricarboxylic acid dianion (CHEBI:36300) |
| isodomoate A(2−) (CHEBI:172367) is conjugate base of isodomoic acid A (CHEBI:176782) |
| Incoming Relation(s) |
| isodomoic acid A (CHEBI:176782) is conjugate acid of isodomoate A(2−) (CHEBI:172367) |
| UniProt Name | Source |
|---|---|
| isodomoate A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-22491 | MetaCyc |
| Citations |
|---|