EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14O2 |
| Net Charge | 0 |
| Average Mass | 274.319 |
| Monoisotopic Mass | 274.09938 |
| SMILES | O=C(O)/C=C/c1ccc(-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C19H14O2/c20-19(21)13-10-14-8-11-16(12-9-14)18-7-3-5-15-4-1-2-6-17(15)18/h1-13H,(H,20,21)/b13-10+ |
| InChIKey | QEFATUBWVYYERM-JLHYYAGUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UAB126 (CHEBI:176496) has role anti-obesity agent (CHEBI:74518) |
| UAB126 (CHEBI:176496) has role antilipemic drug (CHEBI:35679) |
| UAB126 (CHEBI:176496) is a benzenes (CHEBI:22712) |
| UAB126 (CHEBI:176496) is a naphthalenes (CHEBI:25477) |
| UAB126 (CHEBI:176496) is a olefinic compound (CHEBI:78840) |
| UAB126 (CHEBI:176496) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E)-3-[4-(naphthalen-1-yl)phenyl]prop-2-enoic acid |
| Synonym | Source |
|---|---|
| (E)-3-[4-(naphthalen-1-yl)phenyl]prop-2-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2016004066 | Patent |
| Citations |
|---|