EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O3 |
| Net Charge | 0 |
| Average Mass | 256.386 |
| Monoisotopic Mass | 256.20384 |
| SMILES | CC1(CCO)C[C@]2(CC[C@H](C(C)(C)C)CC2)OO1 |
| InChI | InChI=1S/C15H28O3/c1-13(2,3)12-5-7-15(8-6-12)11-14(4,9-10-16)17-18-15/h12,16H,5-11H2,1-4H3/t12-,14?,15+ |
| InChIKey | RWJLCLCUNHUSPG-NNUVIIOVSA-N |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Role: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FINO2 (CHEBI:176420) has role antineoplastic agent (CHEBI:35610) |
| FINO2 (CHEBI:176420) has role ferroptosis inducer (CHEBI:173085) |
| FINO2 (CHEBI:176420) is a organic heterobicyclic compound (CHEBI:27171) |
| FINO2 (CHEBI:176420) is a organic peroxide (CHEBI:25702) |
| FINO2 (CHEBI:176420) is a oxaspiro compound (CHEBI:37948) |
| FINO2 (CHEBI:176420) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 2-[(5s,8s)-8-tert-butyl-3-methyl-1,2-dioxaspiro[4.5]decan-3-yl]ethanol |
| Synonym | Source |
|---|---|
| 2-[(5s,8s)-8-tert-butyl-3-methyl-1,2-dioxaspiro[4.5]decan-3-yl]ethan-1-ol | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:869298-31-7 | ChEBI |
| Citations |
|---|