EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31N3O5S2 |
| Net Charge | 0 |
| Average Mass | 517.673 |
| Monoisotopic Mass | 517.17051 |
| SMILES | O=S(=O)(NC1CCCCC1)c1ccc2c(c1)C(=NO)c1cc(S(=O)(=O)NC3CCCCC3)ccc1-2 |
| InChI | InChI=1S/C25H31N3O5S2/c29-26-25-23-15-19(34(30,31)27-17-7-3-1-4-8-17)11-13-21(23)22-14-12-20(16-24(22)25)35(32,33)28-18-9-5-2-6-10-18/h11-18,27-29H,1-10H2 |
| InChIKey | JLCFMMIWBSZOIS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 1.11.1.9 (glutathione peroxidase) inhibitor An inhibitor of peroxidases (EC 1.11.1.*) that inhibits the action of glutathione peroxidase (EC 1.11.1.9). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FIN56 (CHEBI:176419) has functional parent 9-hydroxyiminofluorene-2,7-disulfonamide (CHEBI:114722) |
| FIN56 (CHEBI:176419) has role EC 1.11.1.9 (glutathione peroxidase) inhibitor (CHEBI:176342) |
| FIN56 (CHEBI:176419) has role ferroptosis inducer (CHEBI:173085) |
| FIN56 (CHEBI:176419) is a fluorenes (CHEBI:24059) |
| FIN56 (CHEBI:176419) is a ketoxime (CHEBI:24983) |
| FIN56 (CHEBI:176419) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N,N'-dicyclohexyl-9-(hydroxyimino)-9H-fluorene-2,7-disulfonamide |
| Synonyms | Source |
|---|---|
| N2,N7-dicyclohexyl-9-(hydroxyimino)-9H-fluorene-2,7-disulfonamide | IUPAC |
| FIN 56 | ChEBI |
| FIN-56 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1083162-61-1 | ChEBI |
| Citations |
|---|