EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11N3O5S2 |
| Net Charge | 0 |
| Average Mass | 353.381 |
| Monoisotopic Mass | 353.01401 |
| SMILES | NS(=O)(=O)c1ccc2c(c1)C(=NO)c1cc(S(N)(=O)=O)ccc1-2 |
| InChI | InChI=1S/C13H11N3O5S2/c14-22(18,19)7-1-3-9-10-4-2-8(23(15,20)21)6-12(10)13(16-17)11(9)5-7/h1-6,17H,(H2,14,18,19)(H2,15,20,21) |
| InChIKey | AAUWIESHYVTZBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-hydroxyiminofluorene-2,7-disulfonamide (CHEBI:114722) is a fluorenes (CHEBI:24059) |
| Incoming Relation(s) |
| FIN56 (CHEBI:176419) has functional parent 9-hydroxyiminofluorene-2,7-disulfonamide (CHEBI:114722) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26184 | LINCS |