EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17637 - 6-methylsalicylic acid
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | Cc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C8H8O3/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4,9H,1H3,(H,10,11) |
| InChIKey | HCJMNOSIAGSZBM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium griseofulvum (ncbitaxon:5078) | - | PubMed (16345795) | |
| Leibnitzia anandria (ncbitaxon:41596) | - | PubMed (24699147) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methylsalicylic acid (CHEBI:17637) has functional parent salicylic acid (CHEBI:16914) |
| 6-methylsalicylic acid (CHEBI:17637) has role Penicillium metabolite (CHEBI:76964) |
| 6-methylsalicylic acid (CHEBI:17637) has role plant metabolite (CHEBI:76924) |
| 6-methylsalicylic acid (CHEBI:17637) is a monohydroxybenzoic acid (CHEBI:25389) |
| 6-methylsalicylic acid (CHEBI:17637) is conjugate acid of 6-methylsalicylate (CHEBI:36658) |
| Incoming Relation(s) |
| 6-methylsalicylate (CHEBI:36658) is conjugate base of 6-methylsalicylic acid (CHEBI:17637) |
| IUPAC Name |
|---|
| 2-hydroxy-6-methylbenzoic acid |
| Synonyms | Source |
|---|---|
| 6-Methylsalicylic acid | KEGG COMPOUND |
| Methylsalicylic acid | KEGG COMPOUND |
| 6-Hydroxy-o-toluic acid | ChemIDplus |
| 2,6-Cresotic acid | ChemIDplus |
| 2-hydroxy-6-methylbenzoic acid | ChemIDplus |
| 6-Methyl-2-hydroxybenzenecarboxylate | KEGG COMPOUND |
| Citations |
|---|