EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:176339 - lanperisone
| Formula | C15H18F3NO |
| Net Charge | 0 |
| Average Mass | 285.309 |
| Monoisotopic Mass | 285.13405 |
| SMILES | C[C@H](CN1CCCC1)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3NO/c1-11(10-19-8-2-3-9-19)14(20)12-4-6-13(7-5-12)15(16,17)18/h4-7,11H,2-3,8-10H2,1H3/t11-/m1/s1 |
| InChIKey | RYZCWZZJFAKYHX-LLVKDONJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | voltage-gated sodium channel blocker Any sodium channel blocker that interferes with the activity of voltage-gated sodium channels. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lanperisone (CHEBI:176339) has role antineoplastic agent (CHEBI:35610) |
| lanperisone (CHEBI:176339) has role calcium channel blocker (CHEBI:38215) |
| lanperisone (CHEBI:176339) has role ferroptosis inducer (CHEBI:173085) |
| lanperisone (CHEBI:176339) has role muscle relaxant (CHEBI:51371) |
| lanperisone (CHEBI:176339) has role voltage-gated sodium channel blocker (CHEBI:38634) |
| lanperisone (CHEBI:176339) is a 2-methyl-3-(pyrrolidin-1-yl)-1-[4-(trifluoromethyl)phenyl]propan-1-one (CHEBI:176340) |
| lanperisone (CHEBI:176339) is conjugate base of lanperisone(1+) (CHEBI:176341) |
| Incoming Relation(s) |
| lanperisone(1+) (CHEBI:176341) is conjugate acid of lanperisone (CHEBI:176339) |
| IUPAC Name |
|---|
| (2R)-2-methyl-3-(pyrrolidin-1-yl)-1-[4-(trifluoromethyl)phenyl]propan-1-one |
| INNs | Source |
|---|---|
| lanperisonum | WHO MedNet |
| lanperisone | WHO MedNet |
| lanperisona | WHO MedNet |
| lanpérisone | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-(R)-2-methyl-3-(1-pyrrolidinyl)-4'-(trifluoromethyl)propiophenone | ChemIDplus |
| (2R)-2-methyl-3-(1-pyrrolidinyl)-1-[4-(trifluoromethyl)phenyl]-1-propanone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Lanperisone | Wikipedia |
| 171991 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:116287-14-0 | ChemIDplus |
| Citations |
|---|