EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O2 |
| Net Charge | 0 |
| Average Mass | 184.279 |
| Monoisotopic Mass | 184.14633 |
| SMILES | CCC/C=C/COC(=O)CC(C)C |
| InChI | InChI=1S/C11H20O2/c1-4-5-6-7-8-13-11(12)9-10(2)3/h6-7,10H,4-5,8-9H2,1-3H3/b7-6+ |
| InChIKey | SAVRWHQEMHIAEB-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | DOI (10.1007/s00217-021-03687-0) | |
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) | ||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) | Strain: | |
| Sambucus williamsii (ncbitaxon:180062) | - | PubMed (27478495) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). flavouring agent A food additive that is used to added improve the taste or odour of a food. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-2-hexenyl isovalerate (CHEBI:172052) has role flavouring agent (CHEBI:35617) |
| (2E)-2-hexenyl isovalerate (CHEBI:172052) has role human metabolite (CHEBI:77746) |
| (2E)-2-hexenyl isovalerate (CHEBI:172052) has role volatile oil component (CHEBI:27311) |
| (2E)-2-hexenyl isovalerate (CHEBI:172052) is a 2-hexenyl isovalerate (CHEBI:176332) |
| IUPAC Name |
|---|
| (2E)-hex-2-en-1-yl 3-methylbutanoate |
| Synonyms | Source |
|---|---|
| (2E)-hex-2-en-1-yl 3-methylbutanoate | LIPID MAPS |
| (2E)-hex-2-en-1-yl 3-methylbutyrate | ChEBI |
| (2E)-hex-2-en-1-yl isovalerate | ChEBI |
| (2E)-hex-2-enyl 3-methylbutyrate | ChEBI |
| (2E)-hex-2-enyl isovalerate | ChEBI |
| FEMA 3930 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 4509340 | ChemSpider |
| FDB017572 | FooDB |
| HMDB0038274 | HMDB |
| LMFA07010717 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30128172 | Reaxys |
| CAS:68698-59-9 | ChemIDplus |
| CAS:68698-59-9 | NIST Chemistry WebBook |
| Citations |
|---|