EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11F2N3O4 |
| Net Charge | 0 |
| Average Mass | 263.200 |
| Monoisotopic Mass | 263.07176 |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C9H11F2N3O4/c10-9(11)6(16)4(3-15)18-7(9)14-2-1-5(12)13-8(14)17/h1-2,4,6-7,15-16H,3H2,(H2,12,13,17)/t4-,6-,7-/m1/s1 |
| InChIKey | SDUQYLNIPVEERB-QPPQHZFASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor An EC 1.17.* (oxidoreductase acting on CH or CH2) inhibitor that inhibits the action of ribonucleoside-diphosphate reductase (EC 1.17.4.1). DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gemcitabine (CHEBI:175901) has role antimetabolite (CHEBI:35221) |
| gemcitabine (CHEBI:175901) has role antineoplastic agent (CHEBI:35610) |
| gemcitabine (CHEBI:175901) has role antiviral drug (CHEBI:36044) |
| gemcitabine (CHEBI:175901) has role DNA synthesis inhibitor (CHEBI:59517) |
| gemcitabine (CHEBI:175901) has role EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor (CHEBI:74213) |
| gemcitabine (CHEBI:175901) has role environmental contaminant (CHEBI:78298) |
| gemcitabine (CHEBI:175901) has role immunosuppressive agent (CHEBI:35705) |
| gemcitabine (CHEBI:175901) has role photosensitizing agent (CHEBI:47868) |
| gemcitabine (CHEBI:175901) has role prodrug (CHEBI:50266) |
| gemcitabine (CHEBI:175901) has role radiosensitizing agent (CHEBI:132992) |
| gemcitabine (CHEBI:175901) has role xenobiotic (CHEBI:35703) |
| gemcitabine (CHEBI:175901) is a organofluorine compound (CHEBI:37143) |
| gemcitabine (CHEBI:175901) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| Incoming Relation(s) |
| gemcitabine hydrochloride (CHEBI:31647) has part gemcitabine (CHEBI:175901) |
| IUPAC Name |
|---|
| 2'-deoxy-2',2'-difluorocytidine |
| INNs | Source |
|---|---|
| gemcitabina | DrugBank |
| gemcitabine | KEGG DRUG |
| gemcitabinum | DrugBank |
| Synonyms | Source |
|---|---|
| 2',2'-Difluorodeoxycytidine | ChemIDplus |
| 2'-Deoxy-2',2'-difluorocytidine | ChemIDplus |
| 4-amino-1-((2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)-tetrahydrofuran-2-yl)pyrimidin-2(1H)-one | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1283 | DrugCentral |
| C07650 | KEGG COMPOUND |
| D02368 | KEGG DRUG |
| DB00441 | DrugBank |
| EP1939198 | Patent |
| EP2108368 | Patent |
| EP2275135 | Patent |
| GB2136425 | Patent |
| Gemcitabine | Wikipedia |
| GEO | PDBeChem |
| LSM-5333 | LINCS |
| US2009124797 | Patent |
| US2010111852 | Patent |
| US4808614 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5382060 | Reaxys |
| Beilstein:5382060 | Beilstein |
| CAS:95058-81-4 | ChemIDplus |
| CAS:95058-81-4 | KEGG DRUG |
| CAS:95058-81-4 | KEGG COMPOUND |
| CAS:95058-81-4 | DrugBank |
| Citations |
|---|