EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:175901 - gemcitabine
| Formula | C9H11F2N3O4 |
| Net Charge | 0 |
| Average Mass | 263.200 |
| Monoisotopic Mass | 263.07176 |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C9H11F2N3O4/c10-9(11)6(16)4(3-15)18-7(9)14-2-1-5(12)13-8(14)17/h1-2,4,6-7,15-16H,3H2,(H2,12,13,17)/t4-,6-,7-/m1/s1 |
| InChIKey | SDUQYLNIPVEERB-QPPQHZFASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor An EC 1.17.* (oxidoreductase acting on CH or CH2) inhibitor that inhibits the action of ribonucleoside-diphosphate reductase (EC 1.17.4.1). antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gemcitabine (CHEBI:175901) has role antimetabolite (CHEBI:35221) |
| gemcitabine (CHEBI:175901) has role antineoplastic agent (CHEBI:35610) |
| gemcitabine (CHEBI:175901) has role antiviral drug (CHEBI:36044) |
| gemcitabine (CHEBI:175901) has role DNA synthesis inhibitor (CHEBI:59517) |
| gemcitabine (CHEBI:175901) has role EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor (CHEBI:74213) |
| gemcitabine (CHEBI:175901) has role environmental contaminant (CHEBI:78298) |
| gemcitabine (CHEBI:175901) has role immunosuppressive agent (CHEBI:35705) |
| gemcitabine (CHEBI:175901) has role photosensitizing agent (CHEBI:47868) |
| gemcitabine (CHEBI:175901) has role prodrug (CHEBI:50266) |
| gemcitabine (CHEBI:175901) has role radiosensitizing agent (CHEBI:132992) |
| gemcitabine (CHEBI:175901) has role xenobiotic (CHEBI:35703) |
| gemcitabine (CHEBI:175901) is a organofluorine compound (CHEBI:37143) |
| gemcitabine (CHEBI:175901) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| Incoming Relation(s) |
| gemcitabine hydrochloride (CHEBI:31647) has part gemcitabine (CHEBI:175901) |
| IUPAC Name |
|---|
| 2'-deoxy-2',2'-difluorocytidine |
| INNs | Source |
|---|---|
| gemcitabina | DrugBank |
| gemcitabine | KEGG DRUG |
| gemcitabinum | DrugBank |
| Synonyms | Source |
|---|---|
| 2',2'-Difluorodeoxycytidine | ChemIDplus |
| 2'-Deoxy-2',2'-difluorocytidine | ChemIDplus |
| 4-amino-1-((2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)-tetrahydrofuran-2-yl)pyrimidin-2(1H)-one | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1283 | DrugCentral |
| C07650 | KEGG COMPOUND |
| D02368 | KEGG DRUG |
| DB00441 | DrugBank |
| EP1939198 | Patent |
| EP2108368 | Patent |
| EP2275135 | Patent |
| GB2136425 | Patent |
| Gemcitabine | Wikipedia |
| GEO | PDBeChem |
| LSM-5333 | LINCS |
| US2009124797 | Patent |
| US2010111852 | Patent |
| US4808614 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5382060 | Reaxys |
| Beilstein:5382060 | Beilstein |
| CAS:95058-81-4 | ChemIDplus |
| CAS:95058-81-4 | KEGG DRUG |
| CAS:95058-81-4 | KEGG COMPOUND |
| CAS:95058-81-4 | DrugBank |
| Citations |
|---|