EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O5 |
| Net Charge | 0 |
| Average Mass | 236.223 |
| Monoisotopic Mass | 236.06847 |
| SMILES | CC1=CC2=C(C=O)C(=O)[C@](C)(O)[C@@H](O)C2=CO1 |
| InChI | InChI=1S/C12H12O5/c1-6-3-7-8(4-13)10(14)12(2,16)11(15)9(7)5-17-6/h3-5,11,15-16H,1-2H3/t11-,12-/m0/s1 |
| InChIKey | QVMUHZHZYCDMAI-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Austdiol (CHEBI:174211) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7R,8S)-7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde |
| Manual Xrefs | Databases |
|---|---|
| 37098 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:53043-28-0 | ChemIDplus |