EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:173119 - (6Z)-nerolidol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C=CC(C)(O)CC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11- |
| InChIKey | FQTLCLSUCSAZDY-KAMYIIQDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conyza bonariensis (ncbitaxon:91242) | - | PubMed (21240765) | |
| Discaria americana (ncbitaxon:262931) | Whole Organism (NCIT:C13413) | PubMed (18266156) | |
| Pulicaria dysenterica (ncbitaxon:56535) | aerial part (BTO:0001658) | DOI (10.1080/10412905.2007.9699296) | |
| Rollinia sericea (IPNI:221796-2) | leaf (BTO:0000713) | DOI (10.1080/10412905.2010.9700361) | |
| Rorida droserifolia (ncbitaxon:511510) | - | PubMed (30253077) | |
| Siparuna guianensis (ncbitaxon:74957) | - | DOI (10.1080/10412905.2001.9699636) | |
| Wurfbainia villosa var. xanthioides (ncbitaxon:252870) | - | PubMed (31035329) |
| Roles Classification |
|---|
| Chemical Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. flavouring agent A food additive that is used to added improve the taste or odour of a food. insect attractant A chemical that attracts insects. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | herbicide A substance used to destroy plant pests. anti-inflammatory agent Any compound that has anti-inflammatory effects. flavouring agent A food additive that is used to added improve the taste or odour of a food. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. cosmetic The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6Z)-nerolidol (CHEBI:173119) is a nerolidol (CHEBI:7524) |
| Incoming Relation(s) |
| (3R,6Z)-nerolidol (CHEBI:176336) is a (6Z)-nerolidol (CHEBI:173119) |
| (3S,6Z)-nerolidol (CHEBI:176337) is a (6Z)-nerolidol (CHEBI:173119) |
| IUPAC Name |
|---|
| (6Z)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol |
| Synonyms | Source |
|---|---|
| cis-nerolidol | ChEBI |
| (Z)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol | ChemIDplus |
| (Z)-nerolidol | ChEBI |
| nerolidol cis-form | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (6Z)-nerolidol | UniProt |
| Citations |
|---|