EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O2 |
| Net Charge | 0 |
| Average Mass | 352.478 |
| Monoisotopic Mass | 352.21508 |
| SMILES | CCOC(=O)c1ccc(NC2CCCCC2)c(NCc2ccccc2)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-2-26-22(25)18-13-14-20(24-19-11-7-4-8-12-19)21(15-18)23-16-17-9-5-3-6-10-17/h3,5-6,9-10,13-15,19,23-24H,2,4,7-8,11-12,16H2,1H3 |
| InChIKey | VHQAJFNLPQULSV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SRS11-92 (CHEBI:173095) has functional parent ferrostatin-1 (CHEBI:173086) |
| SRS11-92 (CHEBI:173095) has role ferroptosis inhibitor (CHEBI:173084) |
| SRS11-92 (CHEBI:173095) is a diamine (CHEBI:23666) |
| SRS11-92 (CHEBI:173095) is a ethyl ester (CHEBI:23990) |
| SRS11-92 (CHEBI:173095) is a secondary amino compound (CHEBI:50995) |
| SRS11-92 (CHEBI:173095) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| ethyl 3-(benzylamino)-4-(cyclohexylamino)benzoate |
| Synonym | Source |
|---|---|
| 4-(cyclohexylamino)-3-[(phenylmethyl)amino]-benzoic acid ethyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1467047-25-1 | ChEBI |
| Citations |
|---|