EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O2 |
| Net Charge | 0 |
| Average Mass | 262.353 |
| Monoisotopic Mass | 262.16813 |
| SMILES | CCOC(=O)c1ccc(NC2CCCCC2)c(N)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-2-19-15(18)11-8-9-14(13(16)10-11)17-12-6-4-3-5-7-12/h8-10,12,17H,2-7,16H2,1H3 |
| InChIKey | UJHBVMHOBZBWMX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferrostatin-1 (CHEBI:173086) has role antifungal agent (CHEBI:35718) |
| ferrostatin-1 (CHEBI:173086) has role antioxidant (CHEBI:22586) |
| ferrostatin-1 (CHEBI:173086) has role ferroptosis inhibitor (CHEBI:173084) |
| ferrostatin-1 (CHEBI:173086) has role neuroprotective agent (CHEBI:63726) |
| ferrostatin-1 (CHEBI:173086) has role radiation protective agent (CHEBI:66987) |
| ferrostatin-1 (CHEBI:173086) has role radical scavenger (CHEBI:48578) |
| ferrostatin-1 (CHEBI:173086) is a ethyl ester (CHEBI:23990) |
| ferrostatin-1 (CHEBI:173086) is a primary arylamine (CHEBI:50471) |
| ferrostatin-1 (CHEBI:173086) is a substituted aniline (CHEBI:48975) |
| Incoming Relation(s) |
| SRS11-92 (CHEBI:173095) has functional parent ferrostatin-1 (CHEBI:173086) |
| IUPAC Name |
|---|
| ethyl 3-amino-4-(cyclohexylamino)benzoate |
| Synonyms | Source |
|---|---|
| 3-amino-4-cyclohexylaminobenzoic acid ethyl ester | ChEBI |
| Fer-1 | ChEBI |
| ferrrostatin 1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:347174-05-4 | ChEBI |
| Citations |
|---|