EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33N4O9P |
| Net Charge | 0 |
| Average Mass | 552.521 |
| Monoisotopic Mass | 552.19852 |
| SMILES | [H][C@@]1(C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)c2cc3c(OC)cccc3n2)C(=O)COP(=O)(O)O)CCNC1=O |
| InChI | InChI=1S/C24H33N4O9P/c1-13(2)9-18(28-24(32)19-11-15-16(26-19)5-4-6-21(15)36-3)23(31)27-17(10-14-7-8-25-22(14)30)20(29)12-37-38(33,34)35/h4-6,11,13-14,17-18,26H,7-10,12H2,1-3H3,(H,25,30)(H,27,31)(H,28,32)(H2,33,34,35)/t14-,17-,18-/m0/s1 |
| InChIKey | FQKALOFOWPDTED-WBAXXEDZSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-07304814 (CHEBI:173073) has functional parent PF-00835231 (CHEBI:172918) |
| PF-07304814 (CHEBI:173073) has role anticoronaviral agent (CHEBI:149553) |
| PF-07304814 (CHEBI:173073) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| PF-07304814 (CHEBI:173073) has role prodrug (CHEBI:50266) |
| PF-07304814 (CHEBI:173073) is a L-leucine derivative (CHEBI:25018) |
| PF-07304814 (CHEBI:173073) is a aromatic ether (CHEBI:35618) |
| PF-07304814 (CHEBI:173073) is a indolecarboxamide (CHEBI:46921) |
| PF-07304814 (CHEBI:173073) is a phosphate monoester (CHEBI:7794) |
| PF-07304814 (CHEBI:173073) is a pyrrolidin-2-ones (CHEBI:74223) |
| PF-07304814 (CHEBI:173073) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (3S)-3-({N-[(4-methoxy-1H-indol-2-yl)carbonyl]-L-leucyl}amino)-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| (3S)-3-{[(2S)-2-{[(4-methoxy-1H-indol-2-yl)carbonyl]amino}-4-methylpentanoyl]amino}-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl dihydrogen phosphate | IUPAC |
| PF 07304814 | DrugBank |
| PF07304814 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB16514 | DrugBank |
| Citations |
|---|