EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32N4O6 |
| Net Charge | 0 |
| Average Mass | 472.542 |
| Monoisotopic Mass | 472.23218 |
| SMILES | [H][C@@]1(C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)c2cc3c(OC)cccc3n2)C(=O)CO)CCNC1=O |
| InChI | InChI=1S/C24H32N4O6/c1-13(2)9-18(23(32)27-17(20(30)12-29)10-14-7-8-25-22(14)31)28-24(33)19-11-15-16(26-19)5-4-6-21(15)34-3/h4-6,11,13-14,17-18,26,29H,7-10,12H2,1-3H3,(H,25,31)(H,27,32)(H,28,33)/t14-,17-,18-/m0/s1 |
| InChIKey | QDIMHKWNHMVDJB-WBAXXEDZSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-00835231 (CHEBI:172918) has role anticoronaviral agent (CHEBI:149553) |
| PF-00835231 (CHEBI:172918) has role drug metabolite (CHEBI:49103) |
| PF-00835231 (CHEBI:172918) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| PF-00835231 (CHEBI:172918) is a L-leucine derivative (CHEBI:25018) |
| PF-00835231 (CHEBI:172918) is a aromatic ether (CHEBI:35618) |
| PF-00835231 (CHEBI:172918) is a indolecarboxamide (CHEBI:46921) |
| PF-00835231 (CHEBI:172918) is a primary alcohol (CHEBI:15734) |
| PF-00835231 (CHEBI:172918) is a pyrrolidin-2-ones (CHEBI:74223) |
| PF-00835231 (CHEBI:172918) is a secondary carboxamide (CHEBI:140325) |
| Incoming Relation(s) |
| PF-07304814 (CHEBI:173073) has functional parent PF-00835231 (CHEBI:172918) |
| IUPAC Name |
|---|
| N-[(2S)-1-({(2S)-4-hydroxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl}amino)-4-methyl-1-oxopentan-2-yl]-4-methoxy-1H-indole-2-carboxamide |
| Synonyms | Source |
|---|---|
| PF 00835231 | ChemIDplus |
| PF-00835231 | ChemIDplus |
| PF00835231 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 9736673 | ChemSpider |
| V2M | PDBeChem |
| WO2005113580 | Patent |
| Citations |
|---|